C18H9F3N2O2S — CID 144870066
5-(3-cyano-5-fluorophenoxy)-3-ethenyl-2,2-difluoro-3-hydroxy-1-benzothiophene-4-carbonitrile (PubChem CID 144870066) has the molecular formula C18H9F3N2O2S and a molecular weight of 374.34 g/mol. Its IUPAC name is 5-(3-cyano-5-fluorophenoxy)-3-ethenyl-2,2-difluoro-3-hydroxy-1-benzothiophene-4-carbonitrile.
| Compound Name | 5-(3-cyano-5-fluorophenoxy)-3-ethenyl-2,2-difluoro-3-hydroxy-1-benzothiophene-4-carbonitrile |
|---|---|
| PubChem CID | 144870066 |
| Molecular Formula | C18H9F3N2O2S |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 5-(3-cyano-5-fluorophenoxy)-3-ethenyl-2,2-difluoro-3-hydroxy-1-benzothiophene-4-carbonitrile |
| SMILES | C=CC1(O)c2c(ccc(Oc3cc(F)cc(C#N)c3)c2C#N)SC1(F)F |
| InChI | InChI=1S/C18H9F3N2O2S/c1-2-17(24)16-13(9-23)14(3-4-15(16)26-18(17,20)21)25-12-6-10(8-22)5-11(19)7-12/h2-7,24H,1H2 |
| InChIKey | BYLIWRZEJCLFNG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|