C16H8F5NO3 — CID 162518148
3-fluoro-5-[(1,2,2,4-tetrafluoro-3,3-dihydroxy-1H-inden-5-yl)oxy]benzonitrile (PubChem CID 162518148) has the molecular formula C16H8F5NO3 and a molecular weight of 357.23 g/mol. Its IUPAC name is 3-fluoro-5-[(1,2,2,4-tetrafluoro-3,3-dihydroxy-1H-inden-5-yl)oxy]benzonitrile.
| Compound Name | 3-fluoro-5-[(1,2,2,4-tetrafluoro-3,3-dihydroxy-1H-inden-5-yl)oxy]benzonitrile |
|---|---|
| PubChem CID | 162518148 |
| Molecular Formula | C16H8F5NO3 |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 3-fluoro-5-[(1,2,2,4-tetrafluoro-3,3-dihydroxy-1H-inden-5-yl)oxy]benzonitrile |
| SMILES | N#Cc1cc(F)cc(Oc2ccc3c(c2F)C(O)(O)C(F)(F)C3F)c1 |
| InChI | InChI=1S/C16H8F5NO3/c17-8-3-7(6-22)4-9(5-8)25-11-2-1-10-12(13(11)18)16(23,24)15(20,21)14(10)19/h1-5,14,23-24H |
| InChIKey | QFSKFSASVRPRLX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|