C18H7B3F5NO — CID 155713473
CID 155713473 (PubChem CID 155713473) has the molecular formula C18H7B3F5NO and a molecular weight of 380.69 g/mol.
| Compound Name | CID 155713473 |
|---|---|
| PubChem CID | 155713473 |
| Molecular Formula | C18H7B3F5NO |
| Molecular Weight | 380.69 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | — |
| SMILES | [B]C1c2c(Oc3cc(F)cc(C#N)c3)ccc3c2C(C1([B])[B])C(F)(F)C3(F)F |
| InChI | InChI=1S/C18H7B3F5NO/c19-15-13-11(28-9-4-7(6-27)3-8(22)5-9)2-1-10-12(13)14(16(15,20)21)18(25,26)17(10,23)24/h1-5,14-15H |
| InChIKey | CLHIPVRXRAXNSP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.69 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|