C18H6B2F5NO2 — CID 155713461
CID 155713461 (PubChem CID 155713461) has the molecular formula C18H6B2F5NO2 and a molecular weight of 384.87 g/mol.
| Compound Name | CID 155713461 |
|---|---|
| PubChem CID | 155713461 |
| Molecular Formula | C18H6B2F5NO2 |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | — |
| SMILES | [B]C1([B])C(=O)c2c(Oc3cc(F)cc(C#N)c3)ccc3c2C1C(F)(F)C3(F)F |
| InChI | InChI=1S/C18H6B2F5NO2/c19-16(20)14-12-10(17(22,23)18(14,24)25)1-2-11(13(12)15(16)27)28-9-4-7(6-26)3-8(21)5-9/h1-5,14H |
| InChIKey | WVKAJNYUVTYJFJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|