C19H10F5NO — CID 155713453
3-fluoro-5-[(2,2,3,3-tetrafluoro-6-methylidene-8-tricyclo[5.3.1.04,11]undeca-1(11),7,9-trienyl)oxy]benzonitrile (PubChem CID 155713453) has the molecular formula C19H10F5NO and a molecular weight of 363.29 g/mol. Its IUPAC name is 3-fluoro-5-[(2,2,3,3-tetrafluoro-6-methylidene-8-tricyclo[5.3.1.04,11]undeca-1(11),7,9-trienyl)oxy]benzonitrile.
| Compound Name | 3-fluoro-5-[(2,2,3,3-tetrafluoro-6-methylidene-8-tricyclo[5.3.1.04,11]undeca-1(11),7,9-trienyl)oxy]benzonitrile |
|---|---|
| PubChem CID | 155713453 |
| Molecular Formula | C19H10F5NO |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 3-fluoro-5-[(2,2,3,3-tetrafluoro-6-methylidene-8-tricyclo[5.3.1.04,11]undeca-1(11),7,9-trienyl)oxy]benzonitrile |
| SMILES | C=C1CC2c3c(ccc(Oc4cc(F)cc(C#N)c4)c31)C(F)(F)C2(F)F |
| InChI | InChI=1S/C19H10F5NO/c1-9-4-14-17-13(18(21,22)19(14,23)24)2-3-15(16(9)17)26-12-6-10(8-25)5-11(20)7-12/h2-3,5-7,14H,1,4H2 |
| InChIKey | QTXDCAREOHWIMV-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|