C17H8ClF6NO2 — CID 146523979
3-chloro-5-[[4-(difluoromethyl)-1,1,2,2-tetrafluoro-3-hydroxy-3H-inden-5-yl]oxy]benzonitrile (PubChem CID 146523979) has the molecular formula C17H8ClF6NO2 and a molecular weight of 407.70 g/mol. Its IUPAC name is 3-chloro-5-[[4-(difluoromethyl)-1,1,2,2-tetrafluoro-3-hydroxy-3H-inden-5-yl]oxy]benzonitrile.
| Compound Name | 3-chloro-5-[[4-(difluoromethyl)-1,1,2,2-tetrafluoro-3-hydroxy-3H-inden-5-yl]oxy]benzonitrile |
|---|---|
| PubChem CID | 146523979 |
| Molecular Formula | C17H8ClF6NO2 |
| Molecular Weight | 407.70 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | 3-chloro-5-[[4-(difluoromethyl)-1,1,2,2-tetrafluoro-3-hydroxy-3H-inden-5-yl]oxy]benzonitrile |
| SMILES | N#Cc1cc(Cl)cc(Oc2ccc3c(c2C(F)F)C(O)C(F)(F)C3(F)F)c1 |
| InChI | InChI=1S/C17H8ClF6NO2/c18-8-3-7(6-25)4-9(5-8)27-11-2-1-10-12(13(11)15(19)20)14(26)17(23,24)16(10,21)22/h1-5,14-15,26H |
| InChIKey | HUJQVVDKKJPQDC-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.70 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|