C14H10F8O2 — CID 146523519
6-(3,3-difluorocyclobutyl)oxy-7-(difluoromethyl)-2,2,3,3-tetrafluoro-1H-inden-1-ol (PubChem CID 146523519) has the molecular formula C14H10F8O2 and a molecular weight of 362.22 g/mol. Its IUPAC name is 6-(3,3-difluorocyclobutyl)oxy-7-(difluoromethyl)-2,2,3,3-tetrafluoro-1H-inden-1-ol.
| Compound Name | 6-(3,3-difluorocyclobutyl)oxy-7-(difluoromethyl)-2,2,3,3-tetrafluoro-1H-inden-1-ol |
|---|---|
| PubChem CID | 146523519 |
| Molecular Formula | C14H10F8O2 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 6-(3,3-difluorocyclobutyl)oxy-7-(difluoromethyl)-2,2,3,3-tetrafluoro-1H-inden-1-ol |
| SMILES | OC1c2c(ccc(OC3CC(F)(F)C3)c2C(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C14H10F8O2/c15-11(16)9-7(24-5-3-12(17,18)4-5)2-1-6-8(9)10(23)14(21,22)13(6,19)20/h1-2,5,10-11,23H,3-4H2 |
| InChIKey | FUIRGMJMDYLWPM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|