C16H8ClF7O2 — CID 146523507
6-(3-chloro-5-fluorophenoxy)-7-(difluoromethyl)-2,2,3,3-tetrafluoro-1H-inden-1-ol (PubChem CID 146523507) has the molecular formula C16H8ClF7O2 and a molecular weight of 400.68 g/mol. Its IUPAC name is 6-(3-chloro-5-fluorophenoxy)-7-(difluoromethyl)-2,2,3,3-tetrafluoro-1H-inden-1-ol.
| Compound Name | 6-(3-chloro-5-fluorophenoxy)-7-(difluoromethyl)-2,2,3,3-tetrafluoro-1H-inden-1-ol |
|---|---|
| PubChem CID | 146523507 |
| Molecular Formula | C16H8ClF7O2 |
| Molecular Weight | 400.68 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | 6-(3-chloro-5-fluorophenoxy)-7-(difluoromethyl)-2,2,3,3-tetrafluoro-1H-inden-1-ol |
| SMILES | OC1c2c(ccc(Oc3cc(F)cc(Cl)c3)c2C(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C16H8ClF7O2/c17-6-3-7(18)5-8(4-6)26-10-2-1-9-11(12(10)14(19)20)13(25)16(23,24)15(9,21)22/h1-5,13-14,25H |
| InChIKey | SBVLBTDIQYFYIQ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.68 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|