C15H8ClF5O3S — CID 138668365
5-(3-chloro-5-fluorophenoxy)-4-(difluoromethyl)-2,2-difluoro-1-benzothiophene-3,3-diol (PubChem CID 138668365) has the molecular formula C15H8ClF5O3S and a molecular weight of 398.74 g/mol. Its IUPAC name is 5-(3-chloro-5-fluorophenoxy)-4-(difluoromethyl)-2,2-difluoro-1-benzothiophene-3,3-diol.
| Compound Name | 5-(3-chloro-5-fluorophenoxy)-4-(difluoromethyl)-2,2-difluoro-1-benzothiophene-3,3-diol |
|---|---|
| PubChem CID | 138668365 |
| Molecular Formula | C15H8ClF5O3S |
| Molecular Weight | 398.74 g/mol |
| Exact Mass | 397.98 |
| IUPAC Name | 5-(3-chloro-5-fluorophenoxy)-4-(difluoromethyl)-2,2-difluoro-1-benzothiophene-3,3-diol |
| SMILES | OC1(O)c2c(ccc(Oc3cc(F)cc(Cl)c3)c2C(F)F)SC1(F)F |
| InChI | InChI=1S/C15H8ClF5O3S/c16-6-3-7(17)5-8(4-6)24-9-1-2-10-12(11(9)13(18)19)14(22,23)15(20,21)25-10/h1-5,13,22-23H |
| InChIKey | MSLQSBOUDLQLGY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.74 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|