C16H7ClF6O2 — CID 166903847
3-chloro-7-(difluoromethyl)-6-(3,5-difluorophenoxy)-2,2-difluoro-3H-inden-1-one (PubChem CID 166903847) has the molecular formula C16H7ClF6O2 and a molecular weight of 380.67 g/mol. Its IUPAC name is 3-chloro-7-(difluoromethyl)-6-(3,5-difluorophenoxy)-2,2-difluoro-3H-inden-1-one.
| Compound Name | 3-chloro-7-(difluoromethyl)-6-(3,5-difluorophenoxy)-2,2-difluoro-3H-inden-1-one |
|---|---|
| PubChem CID | 166903847 |
| Molecular Formula | C16H7ClF6O2 |
| Molecular Weight | 380.67 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | 3-chloro-7-(difluoromethyl)-6-(3,5-difluorophenoxy)-2,2-difluoro-3H-inden-1-one |
| SMILES | O=C1c2c(ccc(Oc3cc(F)cc(F)c3)c2C(F)F)C(Cl)C1(F)F |
| InChI | InChI=1S/C16H7ClF6O2/c17-13-9-1-2-10(25-8-4-6(18)3-7(19)5-8)12(15(20)21)11(9)14(24)16(13,22)23/h1-5,13,15H |
| InChIKey | VMDBPHKJOPSRSH-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.67 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|