C17H8ClF6NO2 — CID 162493420
2-chloro-7-(difluoromethyl)-2,3,3-trifluoro-6-(3-fluoro-5-isocyanophenoxy)-1H-inden-1-ol (PubChem CID 162493420) has the molecular formula C17H8ClF6NO2 and a molecular weight of 407.70 g/mol. Its IUPAC name is 2-chloro-7-(difluoromethyl)-2,3,3-trifluoro-6-(3-fluoro-5-isocyanophenoxy)-1H-inden-1-ol.
| Compound Name | 2-chloro-7-(difluoromethyl)-2,3,3-trifluoro-6-(3-fluoro-5-isocyanophenoxy)-1H-inden-1-ol |
|---|---|
| PubChem CID | 162493420 |
| Molecular Formula | C17H8ClF6NO2 |
| Molecular Weight | 407.70 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | 2-chloro-7-(difluoromethyl)-2,3,3-trifluoro-6-(3-fluoro-5-isocyanophenoxy)-1H-inden-1-ol |
| SMILES | [C-]#[N+]c1cc(F)cc(Oc2ccc3c(c2C(F)F)C(O)C(F)(Cl)C3(F)F)c1 |
| InChI | InChI=1S/C17H8ClF6NO2/c1-25-8-4-7(19)5-9(6-8)27-11-3-2-10-12(13(11)15(20)21)14(26)16(18,22)17(10,23)24/h2-6,14-15,26H |
| InChIKey | WNFFJAWTFVRCHL-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 33.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.70 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|