C19H12F5NO2 — CID 164935906
1,1,2,2-tetrafluoro-6-(3-fluoro-5-isocyanophenoxy)-4,5-dihydro-3H-acenaphthylen-3a-ol (PubChem CID 164935906) has the molecular formula C19H12F5NO2 and a molecular weight of 381.30 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-6-(3-fluoro-5-isocyanophenoxy)-4,5-dihydro-3H-acenaphthylen-3a-ol.
| Compound Name | 1,1,2,2-tetrafluoro-6-(3-fluoro-5-isocyanophenoxy)-4,5-dihydro-3H-acenaphthylen-3a-ol |
|---|---|
| PubChem CID | 164935906 |
| Molecular Formula | C19H12F5NO2 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 1,1,2,2-tetrafluoro-6-(3-fluoro-5-isocyanophenoxy)-4,5-dihydro-3H-acenaphthylen-3a-ol |
| SMILES | [C-]#[N+]c1cc(F)cc(Oc2ccc3c4c2CCCC4(O)C(F)(F)C3(F)F)c1 |
| InChI | InChI=1S/C19H12F5NO2/c1-25-11-7-10(20)8-12(9-11)27-15-5-4-14-16-13(15)3-2-6-17(16,26)19(23,24)18(14,21)22/h4-5,7-9,26H,2-3,6H2 |
| InChIKey | AQIVFCUGOZMLJV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 33.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|