C18H9F6NO3 — CID 164793018
(2S,3S,4S)-3,5,5,6,6-pentafluoro-10-(3-fluoro-5-isocyanophenoxy)tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene-2,4-diol (PubChem CID 164793018) has the molecular formula C18H9F6NO3 and a molecular weight of 401.26 g/mol. Its IUPAC name is (2S,3S,4S)-3,5,5,6,6-pentafluoro-10-(3-fluoro-5-isocyanophenoxy)tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene-2,4-diol.
| Compound Name | (2S,3S,4S)-3,5,5,6,6-pentafluoro-10-(3-fluoro-5-isocyanophenoxy)tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene-2,4-diol |
|---|---|
| PubChem CID | 164793018 |
| Molecular Formula | C18H9F6NO3 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | (2S,3S,4S)-3,5,5,6,6-pentafluoro-10-(3-fluoro-5-isocyanophenoxy)tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene-2,4-diol |
| SMILES | [C-]#[N+]c1cc(F)cc(Oc2ccc3c4c2[C@H](O)[C@H](F)[C@]4(O)C(F)(F)C3(F)F)c1 |
| InChI | InChI=1S/C18H9F6NO3/c1-25-8-4-7(19)5-9(6-8)28-11-3-2-10-13-12(11)14(26)15(20)16(13,27)18(23,24)17(10,21)22/h2-6,14-15,26-27H/t14-,15-,16-/m0/s1 |
| InChIKey | RVMYPXHWUKJGGU-JYJNAYRXSA-N |
| XLogP | 4.48 |
| TPSA | 54.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|