C18H11F5N2O2 — CID 155641094
4-amino-5,5,6,6-tetrafluoro-10-(3-fluoro-5-isocyanophenoxy)tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-ol (PubChem CID 155641094) has the molecular formula C18H11F5N2O2 and a molecular weight of 382.29 g/mol. Its IUPAC name is 4-amino-5,5,6,6-tetrafluoro-10-(3-fluoro-5-isocyanophenoxy)tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-ol.
| Compound Name | 4-amino-5,5,6,6-tetrafluoro-10-(3-fluoro-5-isocyanophenoxy)tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-ol |
|---|---|
| PubChem CID | 155641094 |
| Molecular Formula | C18H11F5N2O2 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 4-amino-5,5,6,6-tetrafluoro-10-(3-fluoro-5-isocyanophenoxy)tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-ol |
| SMILES | [C-]#[N+]c1cc(F)cc(Oc2ccc3c4c2C(O)CC4(N)C(F)(F)C3(F)F)c1 |
| InChI | InChI=1S/C18H11F5N2O2/c1-25-9-4-8(19)5-10(6-9)27-13-3-2-11-15-14(13)12(26)7-16(15,24)18(22,23)17(11,20)21/h2-6,12,26H,7,24H2 |
| InChIKey | ZRZSJWBNMQANCW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|