C19H12F5NO2 — CID 155232168
3-methyl-5-[[(4R,6S)-2,2,3,3,6-pentafluoro-4-hydroxy-8-tricyclo[5.3.1.04,11]undeca-1(11),7,9-trienyl]oxy]benzonitrile (PubChem CID 155232168) has the molecular formula C19H12F5NO2 and a molecular weight of 381.30 g/mol. Its IUPAC name is 3-methyl-5-[[(4R,6S)-2,2,3,3,6-pentafluoro-4-hydroxy-8-tricyclo[5.3.1.04,11]undeca-1(11),7,9-trienyl]oxy]benzonitrile.
| Compound Name | 3-methyl-5-[[(4R,6S)-2,2,3,3,6-pentafluoro-4-hydroxy-8-tricyclo[5.3.1.04,11]undeca-1(11),7,9-trienyl]oxy]benzonitrile |
|---|---|
| PubChem CID | 155232168 |
| Molecular Formula | C19H12F5NO2 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 3-methyl-5-[[(4R,6S)-2,2,3,3,6-pentafluoro-4-hydroxy-8-tricyclo[5.3.1.04,11]undeca-1(11),7,9-trienyl]oxy]benzonitrile |
| SMILES | Cc1cc(C#N)cc(Oc2ccc3c4c2[C@@H](F)C[C@]4(O)C(F)(F)C3(F)F)c1 |
| InChI | InChI=1S/C19H12F5NO2/c1-9-4-10(8-25)6-11(5-9)27-14-3-2-12-16-15(14)13(20)7-17(16,26)19(23,24)18(12,21)22/h2-6,13,26H,7H2,1H3/t13-,17+/m0/s1 |
| InChIKey | GZUQKSKPZLIPLI-SUMWQHHRSA-N |
| XLogP | 5.00 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|