C17H9F6NO3 — CID 162518166
3-[4-(difluoromethyl)-1,1,2,2-tetrafluoro-3,3-dihydroxyinden-5-yl]oxybenzonitrile (PubChem CID 162518166) has the molecular formula C17H9F6NO3 and a molecular weight of 389.25 g/mol. Its IUPAC name is 3-[4-(difluoromethyl)-1,1,2,2-tetrafluoro-3,3-dihydroxyinden-5-yl]oxybenzonitrile.
| Compound Name | 3-[4-(difluoromethyl)-1,1,2,2-tetrafluoro-3,3-dihydroxyinden-5-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 162518166 |
| Molecular Formula | C17H9F6NO3 |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 3-[4-(difluoromethyl)-1,1,2,2-tetrafluoro-3,3-dihydroxyinden-5-yl]oxybenzonitrile |
| SMILES | N#Cc1cccc(Oc2ccc3c(c2C(F)F)C(O)(O)C(F)(F)C3(F)F)c1 |
| InChI | InChI=1S/C17H9F6NO3/c18-14(19)12-11(27-9-3-1-2-8(6-9)7-24)5-4-10-13(12)16(25,26)17(22,23)15(10,20)21/h1-6,14,25-26H |
| InChIKey | OQJLOICZPIPOFT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|