C19H12F5NO3 — CID 166802950
3-fluoro-5-[(2,2,3,3-tetrafluoro-4-hydroxy-6-methoxy-8-tricyclo[5.3.1.04,11]undeca-1(11),7,9-trienyl)oxy]benzonitrile (PubChem CID 166802950) has the molecular formula C19H12F5NO3 and a molecular weight of 397.30 g/mol. Its IUPAC name is 3-fluoro-5-[(2,2,3,3-tetrafluoro-4-hydroxy-6-methoxy-8-tricyclo[5.3.1.04,11]undeca-1(11),7,9-trienyl)oxy]benzonitrile.
| Compound Name | 3-fluoro-5-[(2,2,3,3-tetrafluoro-4-hydroxy-6-methoxy-8-tricyclo[5.3.1.04,11]undeca-1(11),7,9-trienyl)oxy]benzonitrile |
|---|---|
| PubChem CID | 166802950 |
| Molecular Formula | C19H12F5NO3 |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 3-fluoro-5-[(2,2,3,3-tetrafluoro-4-hydroxy-6-methoxy-8-tricyclo[5.3.1.04,11]undeca-1(11),7,9-trienyl)oxy]benzonitrile |
| SMILES | COC1CC2(O)c3c(ccc(Oc4cc(F)cc(C#N)c4)c31)C(F)(F)C2(F)F |
| InChI | InChI=1S/C19H12F5NO3/c1-27-14-7-17(26)16-12(18(21,22)19(17,23)24)2-3-13(15(14)16)28-11-5-9(8-25)4-10(20)6-11/h2-6,14,26H,7H2,1H3 |
| InChIKey | JUIWWUMBAUUNLE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|