C19H10F7NO3 — CID 164935907
1,1,2,2,4,4-hexafluoro-6-(3-fluoro-5-isocyanophenoxy)-3,5-dihydroacenaphthylene-3a,5-diol (PubChem CID 164935907) has the molecular formula C19H10F7NO3 and a molecular weight of 433.28 g/mol. Its IUPAC name is 1,1,2,2,4,4-hexafluoro-6-(3-fluoro-5-isocyanophenoxy)-3,5-dihydroacenaphthylene-3a,5-diol.
| Compound Name | 1,1,2,2,4,4-hexafluoro-6-(3-fluoro-5-isocyanophenoxy)-3,5-dihydroacenaphthylene-3a,5-diol |
|---|---|
| PubChem CID | 164935907 |
| Molecular Formula | C19H10F7NO3 |
| Molecular Weight | 433.28 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | 1,1,2,2,4,4-hexafluoro-6-(3-fluoro-5-isocyanophenoxy)-3,5-dihydroacenaphthylene-3a,5-diol |
| SMILES | [C-]#[N+]c1cc(F)cc(Oc2ccc3c4c2C(O)C(F)(F)CC4(O)C(F)(F)C3(F)F)c1 |
| InChI | InChI=1S/C19H10F7NO3/c1-27-9-4-8(20)5-10(6-9)30-12-3-2-11-14-13(12)15(28)17(21,22)7-16(14,29)19(25,26)18(11,23)24/h2-6,15,28-29H,7H2 |
| InChIKey | OCUWOECTMYQUKK-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 54.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.28 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|