C18H8F7NO2 — CID 158335506
(4S,5S,6S)-2,2,3,3,5,6-hexafluoro-8-(3-fluoro-5-isocyanophenoxy)tricyclo[5.3.1.04,11]undeca-1(11),7,9-trien-4-ol (PubChem CID 158335506) has the molecular formula C18H8F7NO2 and a molecular weight of 403.25 g/mol. Its IUPAC name is (4S,5S,6S)-2,2,3,3,5,6-hexafluoro-8-(3-fluoro-5-isocyanophenoxy)tricyclo[5.3.1.04,11]undeca-1(11),7,9-trien-4-ol.
| Compound Name | (4S,5S,6S)-2,2,3,3,5,6-hexafluoro-8-(3-fluoro-5-isocyanophenoxy)tricyclo[5.3.1.04,11]undeca-1(11),7,9-trien-4-ol |
|---|---|
| PubChem CID | 158335506 |
| Molecular Formula | C18H8F7NO2 |
| Molecular Weight | 403.25 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | (4S,5S,6S)-2,2,3,3,5,6-hexafluoro-8-(3-fluoro-5-isocyanophenoxy)tricyclo[5.3.1.04,11]undeca-1(11),7,9-trien-4-ol |
| SMILES | [C-]#[N+]c1cc(F)cc(Oc2ccc3c4c2[C@H](F)[C@@H](F)[C@]4(O)C(F)(F)C3(F)F)c1 |
| InChI | InChI=1S/C18H8F7NO2/c1-26-8-4-7(19)5-9(6-8)28-11-3-2-10-13-12(11)14(20)15(21)16(13,27)18(24,25)17(10,22)23/h2-6,14-15,27H/t14-,15+,16-/m0/s1 |
| InChIKey | ZTFQXJUPCUMPOF-XHSDSOJGSA-N |
| XLogP | 5.46 |
| TPSA | 33.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.25 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|