C16H8F4N2O3S — CID 140758825
4-(difluoromethyl)-2-fluoro-5-(3-fluoro-5-isocyanophenoxy)-1,1-dioxo-1-benzothiophen-3-imine (PubChem CID 140758825) has the molecular formula C16H8F4N2O3S and a molecular weight of 384.31 g/mol. Its IUPAC name is 4-(difluoromethyl)-2-fluoro-5-(3-fluoro-5-isocyanophenoxy)-1,1-dioxo-1-benzothiophen-3-imine.
| Compound Name | 4-(difluoromethyl)-2-fluoro-5-(3-fluoro-5-isocyanophenoxy)-1,1-dioxo-1-benzothiophen-3-imine |
|---|---|
| PubChem CID | 140758825 |
| Molecular Formula | C16H8F4N2O3S |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | 4-(difluoromethyl)-2-fluoro-5-(3-fluoro-5-isocyanophenoxy)-1,1-dioxo-1-benzothiophen-3-imine |
| SMILES | [H]/N=C1/c2c(ccc(Oc3cc(F)cc([N+]#[C-])c3)c2C(F)F)S(=O)(=O)C1F |
| InChI | InChI=1S/C16H8F4N2O3S/c1-22-8-4-7(17)5-9(6-8)25-10-2-3-11-13(12(10)15(18)19)14(21)16(20)26(11,23)24/h2-6,15-16,21H/b21-14- |
| InChIKey | ZZVHQGKXQVFWJG-STZFKDTASA-N |
| XLogP | 4.56 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|