C32H20F8N4O6S2 — CID 158475891
[4-(difluoromethyl)-5-(3,5-difluorophenoxy)-3-hydroxy-1-oxo-2,3-dihydro-1-benzothiophen-1-ylidene]cyanamide (PubChem CID 158475891) has the molecular formula C32H20F8N4O6S2 and a molecular weight of 772.65 g/mol. Its IUPAC name is [4-(difluoromethyl)-5-(3,5-difluorophenoxy)-3-hydroxy-1-oxo-2,3-dihydro-1-benzothiophen-1-ylidene]cyanamide.
| Compound Name | [4-(difluoromethyl)-5-(3,5-difluorophenoxy)-3-hydroxy-1-oxo-2,3-dihydro-1-benzothiophen-1-ylidene]cyanamide |
|---|---|
| PubChem CID | 158475891 |
| Molecular Formula | C32H20F8N4O6S2 |
| Molecular Weight | 772.65 g/mol |
| Exact Mass | 772.07 |
| IUPAC Name | [4-(difluoromethyl)-5-(3,5-difluorophenoxy)-3-hydroxy-1-oxo-2,3-dihydro-1-benzothiophen-1-ylidene]cyanamide |
| SMILES | N#CN=S1(=O)CC(O)c2c1ccc(Oc1cc(F)cc(F)c1)c2C(F)F.N#CN=S1(=O)CC(O)c2c1ccc(Oc1cc(F)cc(F)c1)c2C(F)F |
| InChI | InChI=1S/2C16H10F4N2O3S/c2*17-8-3-9(18)5-10(4-8)25-12-1-2-13-14(15(12)16(19)20)11(23)6-26(13,24)22-7-21/h2*1-5,11,16,23H,6H2 |
| InChIKey | HGXRZUWIXMAPJF-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 165.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.65 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|