C16H12F3NO3S — CID 146396405
2-(difluoromethyl)-3-(3-fluoro-5-methylphenoxy)-6-methylsulfonylbenzonitrile (PubChem CID 146396405) has the molecular formula C16H12F3NO3S and a molecular weight of 355.34 g/mol. Its IUPAC name is 2-(difluoromethyl)-3-(3-fluoro-5-methylphenoxy)-6-methylsulfonylbenzonitrile.
| Compound Name | 2-(difluoromethyl)-3-(3-fluoro-5-methylphenoxy)-6-methylsulfonylbenzonitrile |
|---|---|
| PubChem CID | 146396405 |
| Molecular Formula | C16H12F3NO3S |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 2-(difluoromethyl)-3-(3-fluoro-5-methylphenoxy)-6-methylsulfonylbenzonitrile |
| SMILES | Cc1cc(F)cc(Oc2ccc(S(C)(=O)=O)c(C#N)c2C(F)F)c1 |
| InChI | InChI=1S/C16H12F3NO3S/c1-9-5-10(17)7-11(6-9)23-13-3-4-14(24(2,21)22)12(8-20)15(13)16(18)19/h3-7,16H,1-2H3 |
| InChIKey | VQAJVOGJJXPXQR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |