C16H8F4N2OS — CID 145060308
3-[[4-(difluoromethyl)-2-fluoro-3-imino-1-benzothiophen-5-yl]oxy]-5-fluorobenzonitrile (PubChem CID 145060308) has the molecular formula C16H8F4N2OS and a molecular weight of 352.31 g/mol. Its IUPAC name is 3-[[4-(difluoromethyl)-2-fluoro-3-imino-1-benzothiophen-5-yl]oxy]-5-fluorobenzonitrile.
| Compound Name | 3-[[4-(difluoromethyl)-2-fluoro-3-imino-1-benzothiophen-5-yl]oxy]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 145060308 |
| Molecular Formula | C16H8F4N2OS |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 3-[[4-(difluoromethyl)-2-fluoro-3-imino-1-benzothiophen-5-yl]oxy]-5-fluorobenzonitrile |
| SMILES | [H]/N=C1/c2c(ccc(Oc3cc(F)cc(C#N)c3)c2C(F)F)SC1F |
| InChI | InChI=1S/C16H8F4N2OS/c17-8-3-7(6-21)4-9(5-8)23-10-1-2-11-13(12(10)15(18)19)14(22)16(20)24-11/h1-5,15-16,22H/b22-14- |
| InChIKey | VXAMNIOMLCXQNV-HMAPJEAMSA-N |
| XLogP | 5.20 |
| TPSA | 56.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|