C19H9F8NO — CID 155590245
3-fluoro-5-[[(6S)-1,1,2,2,6,7,7-heptafluoro-8,8a-dihydro-6H-acenaphthylen-5-yl]oxy]benzonitrile (PubChem CID 155590245) has the molecular formula C19H9F8NO and a molecular weight of 419.27 g/mol. Its IUPAC name is 3-fluoro-5-[[(6S)-1,1,2,2,6,7,7-heptafluoro-8,8a-dihydro-6H-acenaphthylen-5-yl]oxy]benzonitrile.
| Compound Name | 3-fluoro-5-[[(6S)-1,1,2,2,6,7,7-heptafluoro-8,8a-dihydro-6H-acenaphthylen-5-yl]oxy]benzonitrile |
|---|---|
| PubChem CID | 155590245 |
| Molecular Formula | C19H9F8NO |
| Molecular Weight | 419.27 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 3-fluoro-5-[[(6S)-1,1,2,2,6,7,7-heptafluoro-8,8a-dihydro-6H-acenaphthylen-5-yl]oxy]benzonitrile |
| SMILES | N#Cc1cc(F)cc(Oc2ccc3c4c2[C@H](F)C(F)(F)CC4C(F)(F)C3(F)F)c1 |
| InChI | InChI=1S/C19H9F8NO/c20-9-3-8(7-28)4-10(5-9)29-13-2-1-11-14-12(19(26,27)18(11,24)25)6-17(22,23)16(21)15(13)14/h1-5,12,16H,6H2/t12?,16-/m0/s1 |
| InChIKey | NBFLWLWFDPLZGV-INSVYWFGSA-N |
| XLogP | 6.36 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.27 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|