C23H20F5NO — CID 155590250
3-[[(6S)-1-butyl-1,2,2,6-tetrafluoro-6,7,8,8a-tetrahydroacenaphthylen-5-yl]oxy]-5-fluorobenzonitrile (PubChem CID 155590250) has the molecular formula C23H20F5NO and a molecular weight of 421.41 g/mol. Its IUPAC name is 3-[[(6S)-1-butyl-1,2,2,6-tetrafluoro-6,7,8,8a-tetrahydroacenaphthylen-5-yl]oxy]-5-fluorobenzonitrile.
| Compound Name | 3-[[(6S)-1-butyl-1,2,2,6-tetrafluoro-6,7,8,8a-tetrahydroacenaphthylen-5-yl]oxy]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 155590250 |
| Molecular Formula | C23H20F5NO |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 3-[[(6S)-1-butyl-1,2,2,6-tetrafluoro-6,7,8,8a-tetrahydroacenaphthylen-5-yl]oxy]-5-fluorobenzonitrile |
| SMILES | CCCCC1(F)C2CC[C@H](F)c3c(Oc4cc(F)cc(C#N)c4)ccc(c32)C1(F)F |
| InChI | InChI=1S/C23H20F5NO/c1-2-3-8-22(26)16-4-6-18(25)21-19(7-5-17(20(16)21)23(22,27)28)30-15-10-13(12-29)9-14(24)11-15/h5,7,9-11,16,18H,2-4,6,8H2,1H3/t16?,18-,22?/m0/s1 |
| InChIKey | DVCBSYGTRDMDKI-OJCRERRGSA-N |
| XLogP | 7.38 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |