C10H10F5NO5S — CID 175748507
2,5-difluoro-N-[(2S)-1,1,1-trifluoropropan-2-yl]benzamide;sulfuric acid (PubChem CID 175748507) has the molecular formula C10H10F5NO5S and a molecular weight of 351.25 g/mol. Its IUPAC name is 2,5-difluoro-N-[(2S)-1,1,1-trifluoropropan-2-yl]benzamide;sulfuric acid.
| Compound Name | 2,5-difluoro-N-[(2S)-1,1,1-trifluoropropan-2-yl]benzamide;sulfuric acid |
|---|---|
| PubChem CID | 175748507 |
| Molecular Formula | C10H10F5NO5S |
| Molecular Weight | 351.25 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 2,5-difluoro-N-[(2S)-1,1,1-trifluoropropan-2-yl]benzamide;sulfuric acid |
| SMILES | C[C@H](NC(=O)c1cc(F)ccc1F)C(F)(F)F.O=S(=O)(O)O |
| InChI | InChI=1S/C10H8F5NO.H2O4S/c1-5(10(13,14)15)16-9(17)7-4-6(11)2-3-8(7)12;1-5(2,3)4/h2-5H,1H3,(H,16,17);(H2,1,2,3,4)/t5-;/m0./s1 |
| InChIKey | KCSKYCOOWWAHLP-JEDNCBNOSA-N |
| XLogP | 1.99 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|