C16H16Cl2FN3O3 — CID 175748623
2,6-dichloro-5-fluoro-1-[(4-methyl-2-propan-2-yl-3-pyridinyl)carbamoyl]-2H-pyridine-3-carboxylic acid (PubChem CID 175748623) has the molecular formula C16H16Cl2FN3O3 and a molecular weight of 388.23 g/mol. Its IUPAC name is 2,6-dichloro-5-fluoro-1-[(4-methyl-2-propan-2-yl-3-pyridinyl)carbamoyl]-2H-pyridine-3-carboxylic acid.
| Compound Name | 2,6-dichloro-5-fluoro-1-[(4-methyl-2-propan-2-yl-3-pyridinyl)carbamoyl]-2H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 175748623 |
| Molecular Formula | C16H16Cl2FN3O3 |
| Molecular Weight | 388.23 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 2,6-dichloro-5-fluoro-1-[(4-methyl-2-propan-2-yl-3-pyridinyl)carbamoyl]-2H-pyridine-3-carboxylic acid |
| SMILES | Cc1ccnc(C(C)C)c1NC(=O)N1C(Cl)=C(F)C=C(C(=O)O)C1Cl |
| InChI | InChI=1S/C16H16Cl2FN3O3/c1-7(2)11-12(8(3)4-5-20-11)21-16(25)22-13(17)9(15(23)24)6-10(19)14(22)18/h4-7,13H,1-3H3,(H,21,25)(H,23,24) |
| InChIKey | CJQYNBOYMHVPQG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.23 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|