C12H13BrClN3O5 — CID 175748750
(2R)-4-(2-bromo-3-chloro-6-nitrophenyl)-2-(hydroxymethyl)piperazine-1-carboxylic acid (PubChem CID 175748750) has the molecular formula C12H13BrClN3O5 and a molecular weight of 394.61 g/mol. Its IUPAC name is (2R)-4-(2-bromo-3-chloro-6-nitrophenyl)-2-(hydroxymethyl)piperazine-1-carboxylic acid.
| Compound Name | (2R)-4-(2-bromo-3-chloro-6-nitrophenyl)-2-(hydroxymethyl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 175748750 |
| Molecular Formula | C12H13BrClN3O5 |
| Molecular Weight | 394.61 g/mol |
| Exact Mass | 392.97 |
| IUPAC Name | (2R)-4-(2-bromo-3-chloro-6-nitrophenyl)-2-(hydroxymethyl)piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(c2c([N+](=O)[O-])ccc(Cl)c2Br)C[C@@H]1CO |
| InChI | InChI=1S/C12H13BrClN3O5/c13-10-8(14)1-2-9(17(21)22)11(10)15-3-4-16(12(19)20)7(5-15)6-18/h1-2,7,18H,3-6H2,(H,19,20)/t7-/m1/s1 |
| InChIKey | ADVTXJDTLRVYTF-SSDOTTSWSA-N |
| XLogP | 2.17 |
| TPSA | 107.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.61 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|