C15H18BrF3N4O4 — CID 174219943
[(2R)-4-[3-bromo-6-nitro-2-(trifluoromethyl)phenyl]-1-methylpiperazin-2-yl]methyl-methylcarbamic acid (PubChem CID 174219943) has the molecular formula C15H18BrF3N4O4 and a molecular weight of 455.23 g/mol. Its IUPAC name is [(2R)-4-[3-bromo-6-nitro-2-(trifluoromethyl)phenyl]-1-methylpiperazin-2-yl]methyl-methylcarbamic acid.
| Compound Name | [(2R)-4-[3-bromo-6-nitro-2-(trifluoromethyl)phenyl]-1-methylpiperazin-2-yl]methyl-methylcarbamic acid |
|---|---|
| PubChem CID | 174219943 |
| Molecular Formula | C15H18BrF3N4O4 |
| Molecular Weight | 455.23 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | [(2R)-4-[3-bromo-6-nitro-2-(trifluoromethyl)phenyl]-1-methylpiperazin-2-yl]methyl-methylcarbamic acid |
| SMILES | CN(C[C@H]1CN(c2c([N+](=O)[O-])ccc(Br)c2C(F)(F)F)CCN1C)C(=O)O |
| InChI | InChI=1S/C15H18BrF3N4O4/c1-20-5-6-22(8-9(20)7-21(2)14(24)25)13-11(23(26)27)4-3-10(16)12(13)15(17,18)19/h3-4,9H,5-8H2,1-2H3,(H,24,25)/t9-/m0/s1 |
| InChIKey | WKEDWUXQYLPHLM-VIFPVBQESA-N |
| XLogP | 3.11 |
| TPSA | 90.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.23 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|