C24H28F3N3O6 — CID 167194383
tert-butyl N-methyl-N-[[(2R)-4-[6-nitro-3-phenoxy-2-(trifluoromethyl)phenyl]morpholin-2-yl]methyl]carbamate (PubChem CID 167194383) has the molecular formula C24H28F3N3O6 and a molecular weight of 511.50 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[[(2R)-4-[6-nitro-3-phenoxy-2-(trifluoromethyl)phenyl]morpholin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[[(2R)-4-[6-nitro-3-phenoxy-2-(trifluoromethyl)phenyl]morpholin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 167194383 |
| Molecular Formula | C24H28F3N3O6 |
| Molecular Weight | 511.50 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | tert-butyl N-methyl-N-[[(2R)-4-[6-nitro-3-phenoxy-2-(trifluoromethyl)phenyl]morpholin-2-yl]methyl]carbamate |
| SMILES | CN(C[C@H]1CN(c2c([N+](=O)[O-])ccc(Oc3ccccc3)c2C(F)(F)F)CCO1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H28F3N3O6/c1-23(2,3)36-22(31)28(4)14-17-15-29(12-13-34-17)21-18(30(32)33)10-11-19(20(21)24(25,26)27)35-16-8-6-5-7-9-16/h5-11,17H,12-15H2,1-4H3/t17-/m0/s1 |
| InChIKey | UFDBISPUIFOXEX-KRWDZBQOSA-N |
| XLogP | 5.48 |
| TPSA | 94.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.50 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|