C23H26F3N3O6 — CID 167194519
tert-butyl N-[[(2S)-4-[6-nitro-3-phenoxy-2-(trifluoromethyl)phenyl]morpholin-2-yl]methyl]carbamate (PubChem CID 167194519) has the molecular formula C23H26F3N3O6 and a molecular weight of 497.47 g/mol. Its IUPAC name is tert-butyl N-[[(2S)-4-[6-nitro-3-phenoxy-2-(trifluoromethyl)phenyl]morpholin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(2S)-4-[6-nitro-3-phenoxy-2-(trifluoromethyl)phenyl]morpholin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 167194519 |
| Molecular Formula | C23H26F3N3O6 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | tert-butyl N-[[(2S)-4-[6-nitro-3-phenoxy-2-(trifluoromethyl)phenyl]morpholin-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@H]1CN(c2c([N+](=O)[O-])ccc(Oc3ccccc3)c2C(F)(F)F)CCO1 |
| InChI | InChI=1S/C23H26F3N3O6/c1-22(2,3)35-21(30)27-13-16-14-28(11-12-33-16)20-17(29(31)32)9-10-18(19(20)23(24,25)26)34-15-7-5-4-6-8-15/h4-10,16H,11-14H2,1-3H3,(H,27,30)/t16-/m0/s1 |
| InChIKey | CHHFNPNVMOFWQA-INIZCTEOSA-N |
| XLogP | 5.14 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|