C24H30ClN3O5 — CID 167658736
tert-butyl N-[[(3S)-1-[3-(3-chlorophenoxy)-2-methyl-6-nitrophenyl]piperidin-3-yl]methyl]carbamate (PubChem CID 167658736) has the molecular formula C24H30ClN3O5 and a molecular weight of 475.97 g/mol. Its IUPAC name is tert-butyl N-[[(3S)-1-[3-(3-chlorophenoxy)-2-methyl-6-nitrophenyl]piperidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(3S)-1-[3-(3-chlorophenoxy)-2-methyl-6-nitrophenyl]piperidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 167658736 |
| Molecular Formula | C24H30ClN3O5 |
| Molecular Weight | 475.97 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | tert-butyl N-[[(3S)-1-[3-(3-chlorophenoxy)-2-methyl-6-nitrophenyl]piperidin-3-yl]methyl]carbamate |
| SMILES | Cc1c(Oc2cccc(Cl)c2)ccc([N+](=O)[O-])c1N1CCC[C@@H](CNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C24H30ClN3O5/c1-16-21(32-19-9-5-8-18(25)13-19)11-10-20(28(30)31)22(16)27-12-6-7-17(15-27)14-26-23(29)33-24(2,3)4/h5,8-11,13,17H,6-7,12,14-15H2,1-4H3,(H,26,29)/t17-/m0/s1 |
| InChIKey | RQKYFBUWMNSYNI-KRWDZBQOSA-N |
| XLogP | 6.09 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.97 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|