C22H25F2N3O5 — CID 165374431
tert-butyl N-[[(2R)-1-[2-fluoro-3-(2-fluorophenoxy)-6-nitrophenyl]pyrrolidin-2-yl]methyl]carbamate (PubChem CID 165374431) has the molecular formula C22H25F2N3O5 and a molecular weight of 449.45 g/mol. Its IUPAC name is tert-butyl N-[[(2R)-1-[2-fluoro-3-(2-fluorophenoxy)-6-nitrophenyl]pyrrolidin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(2R)-1-[2-fluoro-3-(2-fluorophenoxy)-6-nitrophenyl]pyrrolidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 165374431 |
| Molecular Formula | C22H25F2N3O5 |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | tert-butyl N-[[(2R)-1-[2-fluoro-3-(2-fluorophenoxy)-6-nitrophenyl]pyrrolidin-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@H]1CCCN1c1c([N+](=O)[O-])ccc(Oc2ccccc2F)c1F |
| InChI | InChI=1S/C22H25F2N3O5/c1-22(2,3)32-21(28)25-13-14-7-6-12-26(14)20-16(27(29)30)10-11-18(19(20)24)31-17-9-5-4-8-15(17)23/h4-5,8-11,14H,6-7,12-13H2,1-3H3,(H,25,28)/t14-/m1/s1 |
| InChIKey | HZCGLARLZPBUKL-CQSZACIVSA-N |
| XLogP | 5.16 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|