C19H26FN3O5 — CID 158935948
tert-butyl N-[[(2S)-1-[3-fluoro-6-nitro-2-(2-oxopropyl)phenyl]pyrrolidin-2-yl]methyl]carbamate (PubChem CID 158935948) has the molecular formula C19H26FN3O5 and a molecular weight of 395.43 g/mol. Its IUPAC name is tert-butyl N-[[(2S)-1-[3-fluoro-6-nitro-2-(2-oxopropyl)phenyl]pyrrolidin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(2S)-1-[3-fluoro-6-nitro-2-(2-oxopropyl)phenyl]pyrrolidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 158935948 |
| Molecular Formula | C19H26FN3O5 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | tert-butyl N-[[(2S)-1-[3-fluoro-6-nitro-2-(2-oxopropyl)phenyl]pyrrolidin-2-yl]methyl]carbamate |
| SMILES | CC(=O)Cc1c(F)ccc([N+](=O)[O-])c1N1CCC[C@H]1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H26FN3O5/c1-12(24)10-14-15(20)7-8-16(23(26)27)17(14)22-9-5-6-13(22)11-21-18(25)28-19(2,3)4/h7-8,13H,5-6,9-11H2,1-4H3,(H,21,25)/t13-/m0/s1 |
| InChIKey | JJQMXCBPWCQTFE-ZDUSSCGKSA-N |
| XLogP | 3.36 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|