C24H30N2O6 — CID 167544326
tert-butyl 3-[(2R)-4-(2-methyl-6-nitro-3-phenoxyphenyl)morpholin-2-yl]propanoate (PubChem CID 167544326) has the molecular formula C24H30N2O6 and a molecular weight of 442.51 g/mol. Its IUPAC name is tert-butyl 3-[(2R)-4-(2-methyl-6-nitro-3-phenoxyphenyl)morpholin-2-yl]propanoate.
| Compound Name | tert-butyl 3-[(2R)-4-(2-methyl-6-nitro-3-phenoxyphenyl)morpholin-2-yl]propanoate |
|---|---|
| PubChem CID | 167544326 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | tert-butyl 3-[(2R)-4-(2-methyl-6-nitro-3-phenoxyphenyl)morpholin-2-yl]propanoate |
| SMILES | Cc1c(Oc2ccccc2)ccc([N+](=O)[O-])c1N1CCO[C@H](CCC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C24H30N2O6/c1-17-21(31-18-8-6-5-7-9-18)12-11-20(26(28)29)23(17)25-14-15-30-19(16-25)10-13-22(27)32-24(2,3)4/h5-9,11-12,19H,10,13-16H2,1-4H3/t19-/m1/s1 |
| InChIKey | BPBRLERYURTPNF-LJQANCHMSA-N |
| XLogP | 5.02 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|