C28H26N4O5 — CID 167609607
2-[(8R,8aS)-2-(2-methyl-6-nitro-3-phenoxyphenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-8-yl]isoindole-1,3-dione (PubChem CID 167609607) has the molecular formula C28H26N4O5 and a molecular weight of 498.54 g/mol. Its IUPAC name is 2-[(8R,8aS)-2-(2-methyl-6-nitro-3-phenoxyphenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-8-yl]isoindole-1,3-dione.
| Compound Name | 2-[(8R,8aS)-2-(2-methyl-6-nitro-3-phenoxyphenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-8-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167609607 |
| Molecular Formula | C28H26N4O5 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 2-[(8R,8aS)-2-(2-methyl-6-nitro-3-phenoxyphenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-8-yl]isoindole-1,3-dione |
| SMILES | Cc1c(Oc2ccccc2)ccc([N+](=O)[O-])c1N1CCN2CC[C@@H](N3C(=O)c4ccccc4C3=O)[C@@H]2C1 |
| InChI | InChI=1S/C28H26N4O5/c1-18-25(37-19-7-3-2-4-8-19)12-11-23(32(35)36)26(18)30-16-15-29-14-13-22(24(29)17-30)31-27(33)20-9-5-6-10-21(20)28(31)34/h2-12,22,24H,13-17H2,1H3/t22-,24+/m1/s1 |
| InChIKey | KVXLPPNVMJKJRX-VWNXMTODSA-N |
| XLogP | 4.25 |
| TPSA | 96.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|