C22H25F4N3O4 — CID 163381516
N-[[(3S)-1-[3-(2-fluorophenoxy)-6-nitro-2-(trifluoromethyl)phenyl]piperidin-3-yl]methyl]-2-methoxyethanamine (PubChem CID 163381516) has the molecular formula C22H25F4N3O4 and a molecular weight of 471.45 g/mol. Its IUPAC name is N-[[(3S)-1-[3-(2-fluorophenoxy)-6-nitro-2-(trifluoromethyl)phenyl]piperidin-3-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[(3S)-1-[3-(2-fluorophenoxy)-6-nitro-2-(trifluoromethyl)phenyl]piperidin-3-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 163381516 |
| Molecular Formula | C22H25F4N3O4 |
| Molecular Weight | 471.45 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | N-[[(3S)-1-[3-(2-fluorophenoxy)-6-nitro-2-(trifluoromethyl)phenyl]piperidin-3-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNC[C@@H]1CCCN(c2c([N+](=O)[O-])ccc(Oc3ccccc3F)c2C(F)(F)F)C1 |
| InChI | InChI=1S/C22H25F4N3O4/c1-32-12-10-27-13-15-5-4-11-28(14-15)21-17(29(30)31)8-9-19(20(21)22(24,25)26)33-18-7-3-2-6-16(18)23/h2-3,6-9,15,27H,4-5,10-14H2,1H3/t15-/m0/s1 |
| InChIKey | DEWSSKMWUDDZHC-HNNXBMFYSA-N |
| XLogP | 5.00 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.45 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|