C18H26FN3O4 — CID 70650845
tert-butyl N-ethyl-N-[1-(2-fluoro-6-nitrophenyl)piperidin-3-yl]carbamate (PubChem CID 70650845) has the molecular formula C18H26FN3O4 and a molecular weight of 367.42 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[1-(2-fluoro-6-nitrophenyl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[1-(2-fluoro-6-nitrophenyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 70650845 |
| Molecular Formula | C18H26FN3O4 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | tert-butyl N-ethyl-N-[1-(2-fluoro-6-nitrophenyl)piperidin-3-yl]carbamate |
| SMILES | CCN(C(=O)OC(C)(C)C)C1CCCN(c2c(F)cccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C18H26FN3O4/c1-5-21(17(23)26-18(2,3)4)13-8-7-11-20(12-13)16-14(19)9-6-10-15(16)22(24)25/h6,9-10,13H,5,7-8,11-12H2,1-4H3 |
| InChIKey | CEGQEDMRPYSGFH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|