C21H18Cl2N2O2 — CID 175751730
1-[4-[(1R)-1-aminoethyl]phenyl]-4-chloro-2-hydroxy-5H-phenanthridin-6-one;hydrochloride (PubChem CID 175751730) has the molecular formula C21H18Cl2N2O2 and a molecular weight of 401.29 g/mol. Its IUPAC name is 1-[4-[(1R)-1-aminoethyl]phenyl]-4-chloro-2-hydroxy-5H-phenanthridin-6-one;hydrochloride.
| Compound Name | 1-[4-[(1R)-1-aminoethyl]phenyl]-4-chloro-2-hydroxy-5H-phenanthridin-6-one;hydrochloride |
|---|---|
| PubChem CID | 175751730 |
| Molecular Formula | C21H18Cl2N2O2 |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 1-[4-[(1R)-1-aminoethyl]phenyl]-4-chloro-2-hydroxy-5H-phenanthridin-6-one;hydrochloride |
| SMILES | C[C@@H](N)c1ccc(-c2c(O)cc(Cl)c3[nH]c(=O)c4ccccc4c23)cc1.Cl |
| InChI | InChI=1S/C21H17ClN2O2.ClH/c1-11(23)12-6-8-13(9-7-12)18-17(25)10-16(22)20-19(18)14-4-2-3-5-15(14)21(26)24-20;/h2-11,25H,23H2,1H3,(H,24,26);1H/t11-;/m1./s1 |
| InChIKey | IJPJSJBBTBSLMY-RFVHGSKJSA-N |
| XLogP | 5.15 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|