C23H22ClFN2O2 — CID 175751761
1-[4-[(1R)-1-aminoethyl]phenyl]-7-fluoro-2-methoxy-4-methyl-5H-phenanthridin-6-one;hydrochloride (PubChem CID 175751761) has the molecular formula C23H22ClFN2O2 and a molecular weight of 412.89 g/mol. Its IUPAC name is 1-[4-[(1R)-1-aminoethyl]phenyl]-7-fluoro-2-methoxy-4-methyl-5H-phenanthridin-6-one;hydrochloride.
| Compound Name | 1-[4-[(1R)-1-aminoethyl]phenyl]-7-fluoro-2-methoxy-4-methyl-5H-phenanthridin-6-one;hydrochloride |
|---|---|
| PubChem CID | 175751761 |
| Molecular Formula | C23H22ClFN2O2 |
| Molecular Weight | 412.89 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 1-[4-[(1R)-1-aminoethyl]phenyl]-7-fluoro-2-methoxy-4-methyl-5H-phenanthridin-6-one;hydrochloride |
| SMILES | COc1cc(C)c2[nH]c(=O)c3c(F)cccc3c2c1-c1ccc([C@@H](C)N)cc1.Cl |
| InChI | InChI=1S/C23H21FN2O2.ClH/c1-12-11-18(28-3)19(15-9-7-14(8-10-15)13(2)25)21-16-5-4-6-17(24)20(16)23(27)26-22(12)21;/h4-11,13H,25H2,1-3H3,(H,26,27);1H/t13-;/m1./s1 |
| InChIKey | XTZREMREZXXOHF-BTQNPOSSSA-N |
| XLogP | 5.25 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.89 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|