C15H15F2NO — CID 61034522
1-[4-(2,6-difluoro-4-methoxyphenyl)phenyl]ethanamine (PubChem CID 61034522) has the molecular formula C15H15F2NO and a molecular weight of 263.29 g/mol. Its IUPAC name is 1-[4-(2,6-difluoro-4-methoxyphenyl)phenyl]ethanamine.
| Compound Name | 1-[4-(2,6-difluoro-4-methoxyphenyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 61034522 |
| Molecular Formula | C15H15F2NO |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 1-[4-(2,6-difluoro-4-methoxyphenyl)phenyl]ethanamine |
| SMILES | COc1cc(F)c(-c2ccc(C(C)N)cc2)c(F)c1 |
| InChI | InChI=1S/C15H15F2NO/c1-9(18)10-3-5-11(6-4-10)15-13(16)7-12(19-2)8-14(15)17/h3-9H,18H2,1-2H3 |
| InChIKey | BBWBSVUVQKNSOY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |