C16H19NO3 — CID 78938156
(1R)-1-[4-(3,5-dimethoxyphenoxy)phenyl]ethanamine (PubChem CID 78938156) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is (1R)-1-[4-(3,5-dimethoxyphenoxy)phenyl]ethanamine.
| Compound Name | (1R)-1-[4-(3,5-dimethoxyphenoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 78938156 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (1R)-1-[4-(3,5-dimethoxyphenoxy)phenyl]ethanamine |
| SMILES | COc1cc(OC)cc(Oc2ccc([C@@H](C)N)cc2)c1 |
| InChI | InChI=1S/C16H19NO3/c1-11(17)12-4-6-13(7-5-12)20-16-9-14(18-2)8-15(10-16)19-3/h4-11H,17H2,1-3H3/t11-/m1/s1 |
| InChIKey | VIBJOOBLCLYYFC-LLVKDONJSA-N |
| XLogP | 3.52 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |