C24H28F3N3O6S — CID 175752354
N-hydroxy-4-[4-[[(2-phenylcyclopropyl)amino]methyl]piperidin-1-yl]sulfonylbenzamide;2,2,2-trifluoroacetic acid (PubChem CID 175752354) has the molecular formula C24H28F3N3O6S and a molecular weight of 543.56 g/mol. Its IUPAC name is N-hydroxy-4-[4-[[(2-phenylcyclopropyl)amino]methyl]piperidin-1-yl]sulfonylbenzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-hydroxy-4-[4-[[(2-phenylcyclopropyl)amino]methyl]piperidin-1-yl]sulfonylbenzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175752354 |
| Molecular Formula | C24H28F3N3O6S |
| Molecular Weight | 543.56 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | N-hydroxy-4-[4-[[(2-phenylcyclopropyl)amino]methyl]piperidin-1-yl]sulfonylbenzamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NO)c1ccc(S(=O)(=O)N2CCC(CNC3CC3c3ccccc3)CC2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H27N3O4S.C2HF3O2/c26-22(24-27)18-6-8-19(9-7-18)30(28,29)25-12-10-16(11-13-25)15-23-21-14-20(21)17-4-2-1-3-5-17;3-2(4,5)1(6)7/h1-9,16,20-21,23,27H,10-15H2,(H,24,26);(H,6,7) |
| InChIKey | XHWRWJKSBOZJGF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|