C25H29F3N4O5 — CID 175752167
N-hydroxy-4-[[4-[2-[(2-phenylcyclopropyl)amino]acetyl]piperazin-1-yl]methyl]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 175752167) has the molecular formula C25H29F3N4O5 and a molecular weight of 522.52 g/mol. Its IUPAC name is N-hydroxy-4-[[4-[2-[(2-phenylcyclopropyl)amino]acetyl]piperazin-1-yl]methyl]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-hydroxy-4-[[4-[2-[(2-phenylcyclopropyl)amino]acetyl]piperazin-1-yl]methyl]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175752167 |
| Molecular Formula | C25H29F3N4O5 |
| Molecular Weight | 522.52 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | N-hydroxy-4-[[4-[2-[(2-phenylcyclopropyl)amino]acetyl]piperazin-1-yl]methyl]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NO)c1ccc(CN2CCN(C(=O)CNC3CC3c3ccccc3)CC2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H28N4O3.C2HF3O2/c28-22(15-24-21-14-20(21)18-4-2-1-3-5-18)27-12-10-26(11-13-27)16-17-6-8-19(9-7-17)23(29)25-30;3-2(4,5)1(6)7/h1-9,20-21,24,30H,10-16H2,(H,25,29);(H,6,7) |
| InChIKey | PMLAVGWQPCWMJH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|