C26H38N4O6S2 — CID 175754816
tert-butyl 4,6,7,7a-tetrahydro-3aH-[1,3,2]dioxathiolo[4,5-c]pyridine-5-carboxylate;tert-butyl 7-cyano-7-(4-methyl-1,3-thiazol-2-yl)-3-azabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 175754816) has the molecular formula C26H38N4O6S2 and a molecular weight of 566.75 g/mol. Its IUPAC name is tert-butyl 4,6,7,7a-tetrahydro-3aH-[1,3,2]dioxathiolo[4,5-c]pyridine-5-carboxylate;tert-butyl 7-cyano-7-(4-methyl-1,3-thiazol-2-yl)-3-azabicyclo[4.1.0]heptane-3-carboxylate.
| Compound Name | tert-butyl 4,6,7,7a-tetrahydro-3aH-[1,3,2]dioxathiolo[4,5-c]pyridine-5-carboxylate;tert-butyl 7-cyano-7-(4-methyl-1,3-thiazol-2-yl)-3-azabicyclo[4.1.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 175754816 |
| Molecular Formula | C26H38N4O6S2 |
| Molecular Weight | 566.75 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | tert-butyl 4,6,7,7a-tetrahydro-3aH-[1,3,2]dioxathiolo[4,5-c]pyridine-5-carboxylate;tert-butyl 7-cyano-7-(4-methyl-1,3-thiazol-2-yl)-3-azabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2OSOC2C1.Cc1csc(C2(C#N)C3CCN(C(=O)OC(C)(C)C)CC32)n1 |
| InChI | InChI=1S/C16H21N3O2S.C10H17NO4S/c1-10-8-22-13(18-10)16(9-17)11-5-6-19(7-12(11)16)14(20)21-15(2,3)4;1-10(2,3)13-9(12)11-5-4-7-8(6-11)15-16-14-7/h8,11-12H,5-7H2,1-4H3;7-8H,4-6H2,1-3H3 |
| InChIKey | KVBPGHRJTKYCJP-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 114.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.75 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|