C27H38N4O6S — CID 175754856
tert-butyl 4,6,7,7a-tetrahydro-3aH-[1,3,2]dioxathiolo[4,5-c]pyridine-5-carboxylate;tert-butyl 7-cyano-7-pyridin-2-yl-3-azabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 175754856) has the molecular formula C27H38N4O6S and a molecular weight of 546.69 g/mol. Its IUPAC name is tert-butyl 4,6,7,7a-tetrahydro-3aH-[1,3,2]dioxathiolo[4,5-c]pyridine-5-carboxylate;tert-butyl 7-cyano-7-pyridin-2-yl-3-azabicyclo[4.1.0]heptane-3-carboxylate.
| Compound Name | tert-butyl 4,6,7,7a-tetrahydro-3aH-[1,3,2]dioxathiolo[4,5-c]pyridine-5-carboxylate;tert-butyl 7-cyano-7-pyridin-2-yl-3-azabicyclo[4.1.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 175754856 |
| Molecular Formula | C27H38N4O6S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | tert-butyl 4,6,7,7a-tetrahydro-3aH-[1,3,2]dioxathiolo[4,5-c]pyridine-5-carboxylate;tert-butyl 7-cyano-7-pyridin-2-yl-3-azabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2C(C1)C2(C#N)c1ccccn1.CC(C)(C)OC(=O)N1CCC2OSOC2C1 |
| InChI | InChI=1S/C17H21N3O2.C10H17NO4S/c1-16(2,3)22-15(21)20-9-7-12-13(10-20)17(12,11-18)14-6-4-5-8-19-14;1-10(2,3)13-9(12)11-5-4-7-8(6-11)15-16-14-7/h4-6,8,12-13H,7,9-10H2,1-3H3;7-8H,4-6H2,1-3H3 |
| InChIKey | LMKLMAVXYXWVQC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 114.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|