C27H32Br2Cl2N4O10 — CID 175754843
tert-butyl N-(4-bromo-3-chloro-2-nitrophenyl)carbamate;tert-butyl N-(4-bromo-3-chloro-2-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 175754843) has the molecular formula C27H32Br2Cl2N4O10 and a molecular weight of 803.28 g/mol. Its IUPAC name is tert-butyl N-(4-bromo-3-chloro-2-nitrophenyl)carbamate;tert-butyl N-(4-bromo-3-chloro-2-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-(4-bromo-3-chloro-2-nitrophenyl)carbamate;tert-butyl N-(4-bromo-3-chloro-2-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 175754843 |
| Molecular Formula | C27H32Br2Cl2N4O10 |
| Molecular Weight | 803.28 g/mol |
| Exact Mass | 799.99 |
| IUPAC Name | tert-butyl N-(4-bromo-3-chloro-2-nitrophenyl)carbamate;tert-butyl N-(4-bromo-3-chloro-2-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1ccc(Br)c(Cl)c1[N+](=O)[O-].CC(C)(C)OC(=O)Nc1ccc(Br)c(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H20BrClN2O6.C11H12BrClN2O4/c1-15(2,3)25-13(21)19(14(22)26-16(4,5)6)10-8-7-9(17)11(18)12(10)20(23)24;1-11(2,3)19-10(16)14-7-5-4-6(12)8(13)9(7)15(17)18/h7-8H,1-6H3;4-5H,1-3H3,(H,14,16) |
| InChIKey | BRLPPPOUYVOUEU-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 180.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.28 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|