C19H17BO3 — CID 175755674
(7,7-dimethylbenzo[a]phenalen-3-yl)oxyboronic acid (PubChem CID 175755674) has the molecular formula C19H17BO3 and a molecular weight of 304.15 g/mol. Its IUPAC name is (7,7-dimethylbenzo[a]phenalen-3-yl)oxyboronic acid.
| Compound Name | (7,7-dimethylbenzo[a]phenalen-3-yl)oxyboronic acid |
|---|---|
| PubChem CID | 175755674 |
| Molecular Formula | C19H17BO3 |
| Molecular Weight | 304.15 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | (7,7-dimethylbenzo[a]phenalen-3-yl)oxyboronic acid |
| SMILES | CC1(C)c2ccccc2-c2ccc(OB(O)O)c3cccc1c23 |
| InChI | InChI=1S/C19H17BO3/c1-19(2)15-8-4-3-6-12(15)13-10-11-17(23-20(21)22)14-7-5-9-16(19)18(13)14/h3-11,21-22H,1-2H3 |
| InChIKey | UZFYDBGWIVXSSQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.15 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|