(7,7-dimethylbenzo[a]phenalen-3-yl)oxyboronic acid

C19H17BO3 — CID 175755674

IUPAC(7,7-dimethylbenzo[a]phenalen-3-yl)oxyboronic acid
SMILESCC1(C)c2ccccc2-c2ccc(OB(O)O)c3cccc1c23
InChIInChI=1S/C19H17BO3/c1-19(2)15-8-4-3-6-12(15)13-10-11-17(23-20(21)22)14-7-5-9-16(19)18(13)14/h3-11,21-22H,1-2H3
InChIKeyUZFYDBGWIVXSSQ-UHFFFAOYSA-N
MW304.15 g/mol
LogP3.49
Rot. Bonds2

About (7,7-dimethylbenzo[a]phenalen-3-yl)oxyboronic acid

(7,7-dimethylbenzo[a]phenalen-3-yl)oxyboronic acid (PubChem CID 175755674) has the molecular formula C19H17BO3 and a molecular weight of 304.15 g/mol. Its IUPAC name is (7,7-dimethylbenzo[a]phenalen-3-yl)oxyboronic acid.

Molecular Properties

Compound Name(7,7-dimethylbenzo[a]phenalen-3-yl)oxyboronic acid
PubChem CID175755674
Molecular FormulaC19H17BO3
Molecular Weight304.15 g/mol
Exact Mass304.13
IUPAC Name(7,7-dimethylbenzo[a]phenalen-3-yl)oxyboronic acid
SMILESCC1(C)c2ccccc2-c2ccc(OB(O)O)c3cccc1c23
InChIInChI=1S/C19H17BO3/c1-19(2)15-8-4-3-6-12(15)13-10-11-17(23-20(21)22)14-7-5-9-16(19)18(13)14/h3-11,21-22H,1-2H3
InChIKeyUZFYDBGWIVXSSQ-UHFFFAOYSA-N
XLogP3.49
TPSA49.69 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500304.15
LogP ≤ 53.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (7,7-dimethylbenzo[a]phenalen-3-yl)oxyboronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (7,7-dimethylbenzo[a]phenalen-3-yl)oxyboronic acid?
The IUPAC name of (7,7-dimethylbenzo[a]phenalen-3-yl)oxyboronic acid (CID 175755674) is (7,7-dimethylbenzo[a]phenalen-3-yl)oxyboronic acid.
What is the SMILES notation for (7,7-dimethylbenzo[a]phenalen-3-yl)oxyboronic acid?
The canonical SMILES for (7,7-dimethylbenzo[a]phenalen-3-yl)oxyboronic acid is CC1(C)c2ccccc2-c2ccc(OB(O)O)c3cccc1c23.
What is the InChIKey of (7,7-dimethylbenzo[a]phenalen-3-yl)oxyboronic acid?
The InChIKey is UZFYDBGWIVXSSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17BO3/c1-19(2)15-8-4-3-6-12(15)13-10-11-17(23-20(21)22)14-7-5-9-16(19)18(13)14/h3-11,21-22H,1-2H3.
What are the key properties of (7,7-dimethylbenzo[a]phenalen-3-yl)oxyboronic acid?
(7,7-dimethylbenzo[a]phenalen-3-yl)oxyboronic acid has a molecular weight of 304.15 g/mol, XLogP of 3.49, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7,7-dimethylbenzo[a]phenalen-3-yl)oxyboronic acid is sourced from PubChem (CID 175755674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).