C11H17FN2O — CID 175756650
1-(2-fluoro-5-methoxycyclohexa-1,3-dien-1-yl)piperazine (PubChem CID 175756650) has the molecular formula C11H17FN2O and a molecular weight of 212.27 g/mol. Its IUPAC name is 1-(2-fluoro-5-methoxycyclohexa-1,3-dien-1-yl)piperazine.
| Compound Name | 1-(2-fluoro-5-methoxycyclohexa-1,3-dien-1-yl)piperazine |
|---|---|
| PubChem CID | 175756650 |
| Molecular Formula | C11H17FN2O |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 1-(2-fluoro-5-methoxycyclohexa-1,3-dien-1-yl)piperazine |
| SMILES | COC1C=CC(F)=C(N2CCNCC2)C1 |
| InChI | InChI=1S/C11H17FN2O/c1-15-9-2-3-10(12)11(8-9)14-6-4-13-5-7-14/h2-3,9,13H,4-8H2,1H3 |
| InChIKey | XGMIRNBQAPFTOL-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |