C14H25NO5S — CID 175761391
tert-butyl 3-methylsulfonyloxy-2-azaspiro[3.5]nonane-2-carboxylate (PubChem CID 175761391) has the molecular formula C14H25NO5S and a molecular weight of 319.42 g/mol. Its IUPAC name is tert-butyl 3-methylsulfonyloxy-2-azaspiro[3.5]nonane-2-carboxylate.
| Compound Name | tert-butyl 3-methylsulfonyloxy-2-azaspiro[3.5]nonane-2-carboxylate |
|---|---|
| PubChem CID | 175761391 |
| Molecular Formula | C14H25NO5S |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | tert-butyl 3-methylsulfonyloxy-2-azaspiro[3.5]nonane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(CCCCC2)C1OS(C)(=O)=O |
| InChI | InChI=1S/C14H25NO5S/c1-13(2,3)19-12(16)15-10-14(8-6-5-7-9-14)11(15)20-21(4,17)18/h11H,5-10H2,1-4H3 |
| InChIKey | GQKVMBWIVLSVLA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|